Products 147568-66-9
CAS 147568-66-9 is the registry number for Carmoterol, 99.36%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
8-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1H-quinolin-2-one (CAS 147568-66-9) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: 8-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1H-quinolin-2-one. InChIKey: IHOXNOQMRZISPV-YJYMSZOUSA-N.
| Molecular formula | C21H24N2O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 8-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1H-quinolin-2-one |
| InChIKey | IHOXNOQMRZISPV-YJYMSZOUSA-N |
| SMILES | C[C@H](CC1=CC=C(C=C1)OC)NC[C@@H](C2=C3C=CC(=O)NC3=C(C=C2)O)O |
Computed by PubChem (NCBI)