CAS 105047-45-8 appears in our catalog under these names: Fmoc–Lys–OH, Fmoc-Lys-OH/ 98.19% (existing batch purity), Fmoc-L-Lys-OH, Fmoc-Lys-OH, Fmoc-Lys-OH, 99.93%. Offered by: GLPBio, TargetMol, Iris Biotech, Biosynth, MedChemExpress. Available pack sizes: 100g, 5g, 1g, 25g, 0,025kg, 0,05kg, 0,1kg, 0,5kg.
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 105047-45-8) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: YRKFMPDOFHQWPI-IBGZPJMESA-N.
| Molecular formula | C21H24N2O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | YRKFMPDOFHQWPI-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)