Products 350797-54-5
CAS 350797-54-5 appears in our catalog under these names: Silodosin Impurity 52, 2,3-Dihydro-5-(2-nitropropyl)-1H-indole-1-propanol 1-Benzoate. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
3-[5-(2-nitropropyl)-2,3-dihydroindol-1-yl]propyl benzoate (CAS 350797-54-5) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: 3-[5-(2-nitropropyl)-2,3-dihydroindol-1-yl]propyl benzoate. InChIKey: SZTDPSJFESSCOD-UHFFFAOYSA-N.
| Molecular formula | C21H24N2O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 3-[5-(2-nitropropyl)-2,3-dihydroindol-1-yl]propyl benzoate |
| InChIKey | SZTDPSJFESSCOD-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)N(CC2)CCCOC(=O)C3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)