CAS 84624-28-2 appears in our catalog under these names: H–Lys(Fmoc)–OH, H-L-Lys(Fmoc)-OH, Ne-Fmoc-L-lysine, H-Lys(Fmoc)-OH 95%, H-Lys(Fmoc)-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 50g, 5kg.
(2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 84624-28-2) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: (2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: RAQBUPMYCNRBCQ-IBGZPJMESA-N.
| Molecular formula | C21H24N2O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | RAQBUPMYCNRBCQ-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)