Products 14343-87-4
CAS 14343-87-4 is the registry number for (Z)-Triprolidine Oxalate Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
2-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]pyridine;oxalic acid (CAS 14343-87-4) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: 2-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]pyridine;oxalic acid. InChIKey: QZMZFLHINGHPPE-VVTVMFAVSA-N.
| Molecular formula | C21H24N2O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 2-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]pyridine;oxalic acid |
| InChIKey | QZMZFLHINGHPPE-VVTVMFAVSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=C/CN2CCCC2)/C3=CC=CC=N3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(Z)-Triprolidine Oxalate Salt