CAS 2237054-53-2 appears in our catalog under these names: Tubulin inhibitor 1, 99%, Tubulin inhibitor 1, Tubulin inhibitor 1, 99.67%, 99.67%, Tubulin inhibitor 1, 99.81%. Offered by: AmBeed, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 2mg, 50mg, 25mg, 5mg, 10mg, 25 mg, 50 mg.
4-(4-ethoxyphenyl)-1-methyl-3-(3,4,5-trimethoxyphenyl)pyrazole (CAS 2237054-53-2) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: 4-(4-ethoxyphenyl)-1-methyl-3-(3,4,5-trimethoxyphenyl)pyrazole. InChIKey: YWYCRTNRTJCKHS-UHFFFAOYSA-N.
| Molecular formula | C21H24N2O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-(4-ethoxyphenyl)-1-methyl-3-(3,4,5-trimethoxyphenyl)pyrazole |
| InChIKey | YWYCRTNRTJCKHS-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=CN(N=C2C3=CC(=C(C(=C3)OC)OC)OC)C |
Computed by PubChem (NCBI)