cas: 141743-16-0 — see every product listed under this CAS number, including other names
Fmoc-N-(tert-butyloxycarbonylmethyl)glycine, 98% (CAS 141743-16-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689875-1G |
| cas | 141743-16-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1320.39 Pln | |
| Fluorochem | 10g | 2497.06 Pln | |
| Fluorochem | 25g | 6011.44 Pln | |
| Fluorochem | 100g | 19157.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetic acid (CAS 141743-16-0) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetic acid. InChIKey: FZHJLRKZIINJMC-UHFFFAOYSA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetic acid |
| InChIKey | FZHJLRKZIINJMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)