cas: 77284-32-3 — see every product listed under this CAS number, including other names
Fmoc-Nle-OH 97% (CAS 77284-32-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A200227-1g |
| cas | 77284-32-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 720.81 Pln | |
| Ambeed | 500g | 3312.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A200227 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 77284-32-3) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: VCFCFPNRQDANPN-IBGZPJMESA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | VCFCFPNRQDANPN-IBGZPJMESA-N |
| SMILES | CCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)