cas: 199006-54-7 — see every product listed under this CAS number, including other names
Fmoc-Phe(4-Me)-OH, 98%, 98% (CAS 199006-54-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 250mg, 1g, 5g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BV8-25g |
| cas | 199006-54-7 |
| size | 25g |
| availability | 106.65g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 597.20 Pln | |
| Chemat | 50g | 1125.20 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 280.40 Pln | |
| Chemat | 100g | 2162.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid (CAS 199006-54-7) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid. InChIKey: UXLHLZHGQPDMJQ-QHCPKHFHSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid |
| InChIKey | UXLHLZHGQPDMJQ-QHCPKHFHSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)