CAS 204260-38-8 appears in our catalog under these names: Fmoc-4-methyl-d-phenylalanine, 97%, Fmoc–p–Me–D–Phe–OH, Fmoc-D-Phe(4-Me)-OH, Fmoc-D-Phe(4-Me)-OH 98%, Fmoc-D-Phe(4-Me)-OH, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg, 50g, 100g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid (CAS 204260-38-8) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid. InChIKey: UXLHLZHGQPDMJQ-HSZRJFAPSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid |
| InChIKey | UXLHLZHGQPDMJQ-HSZRJFAPSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)