Fmoc-Pra-OH, 99.93%
cas: 198561-07-8 — see every product listed under this CAS number, including other names
Fmoc-Pra-OH, 99.93% (CAS 198561-07-8) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011210-5 g |
| cas | 198561-07-8 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 10 g | 542.60 Pln | |
| MedChemExpress | 100 g | 4262.45 Pln | |
| MedChemExpress | 25 g | 1155.61 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.93% |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid (CAS 198561-07-8) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid. InChIKey: DJGMNCKHNMRKFM-SFHVURJKSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid |
| InChIKey | DJGMNCKHNMRKFM-SFHVURJKSA-N |
| SMILES | C#CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-L-Propargylglycine, Fmoc-Pra-OH, Fmoc-propargyl-Gly-OH, (S)-2-(Fmoc-amino)-4-pentynoic acid, (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid, 4-Pentynoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (2S)-, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)pent-4-ynoic acid, (2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pent-4-ynoic acid, (S)-2-(((9H-fluoren-9-yl)methoxy)carbonylamino)pent-4-ynoic acid, Fmoc-Gly(propargyl)-OH