cas: 73731-37-0 — see every product listed under this CAS number, including other names
Fmoc-Thr-OH, 95%, 95% (CAS 73731-37-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QNM-5g |
| cas | 73731-37-0 |
| size | 5g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 174.80 Pln | |
| Chemat | 500g | 700.80 Pln | |
| Chemat | 250g | 347.60 Pln | |
| Chemat | 1kg | 1307.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid (CAS 73731-37-0) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid. InChIKey: OYULCCKKLJPNPU-DIFFPNOSSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid |
| InChIKey | OYULCCKKLJPNPU-DIFFPNOSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)