CAS 247021-90-5 appears in our catalog under these names: Weinreb Linker, Weinreb Linker 98%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methoxy)amino)propanoic acid, 97%, 97%, N-Fmoc-N-methoxy-3-aminopropionic acid, 99.80%, Weinreb linker, 97%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg, 1 g, 5 g.
3-[9H-fluoren-9-ylmethoxycarbonyl(methoxy)amino]propanoic acid (CAS 247021-90-5) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: 3-[9H-fluoren-9-ylmethoxycarbonyl(methoxy)amino]propanoic acid. InChIKey: ROUNCJXPHYHPTH-UHFFFAOYSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 3-[9H-fluoren-9-ylmethoxycarbonyl(methoxy)amino]propanoic acid |
| InChIKey | ROUNCJXPHYHPTH-UHFFFAOYSA-N |
| SMILES | CON(CCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)