cas: 15191-21-6 — see every product listed under this CAS number, including other names
For-His-OH 95% (CAS 15191-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A791186-100mg |
| cas | 15191-21-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 464.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A791186 |
(2S)-2-formamido-3-(1H-imidazol-5-yl)propanoic acid (CAS 15191-21-6) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: (2S)-2-formamido-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: WFQVSLVQIFFQQN-LURJTMIESA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | (2S)-2-formamido-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | WFQVSLVQIFFQQN-LURJTMIESA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)NC=O |
Computed by PubChem (NCBI)