CAS 957511-87-4 is the registry number for 1-(5-Methyl-3-nitro-1h-pyrazol-1-yl)acetone, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(5-methyl-3-nitropyrazol-1-yl)propan-2-one (CAS 957511-87-4) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: 1-(5-methyl-3-nitropyrazol-1-yl)propan-2-one. InChIKey: QPBIALMZSYFKER-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 1-(5-methyl-3-nitropyrazol-1-yl)propan-2-one |
| InChIKey | QPBIALMZSYFKER-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)