CAS 648917-64-0 appears in our catalog under these names: (3-Methoxy-4-nitrophenyl)hydrazine, 95%, (3-Methoxy-4-nitrophenyl)hydrazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
(3-methoxy-4-nitrophenyl)hydrazine (CAS 648917-64-0) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: (3-methoxy-4-nitrophenyl)hydrazine. InChIKey: PCZJMSVFHJMNSC-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | (3-methoxy-4-nitrophenyl)hydrazine |
| InChIKey | PCZJMSVFHJMNSC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)