CAS 359436-60-5 is the registry number for 3-Maleimidopropionic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3-(2,5-dioxopyrrol-1-yl)propanehydrazide (CAS 359436-60-5) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: 3-(2,5-dioxopyrrol-1-yl)propanehydrazide. InChIKey: PATQAHLJQRPGRQ-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 3-(2,5-dioxopyrrol-1-yl)propanehydrazide |
| InChIKey | PATQAHLJQRPGRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NN |
Computed by PubChem (NCBI)