CAS 50798-38-4 is the registry number for 2-[(3-Nitro-2-pyridinyl)amino]ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 50g, 1g, 25g, 10g, 5g.
2-[(3-nitro-2-pyridinyl)amino]ethanol (CAS 50798-38-4) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: 2-[(3-nitro-2-pyridinyl)amino]ethanol. InChIKey: KSBCSRCDLQUKSY-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 2-[(3-nitro-2-pyridinyl)amino]ethanol |
| InChIKey | KSBCSRCDLQUKSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)