CAS 15191-21-6 appears in our catalog under these names: N-Formyl-l-histidine, 95%, N–Formyl–L–histidine, N-Formyl-L-histidine, >98.0%(T), (S)-2-Formamido-3-(1H-imidazol-4-yl)propanoic acid, 95%, 95%, N-Formyl-L-histidine. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 1 g, 100 mg, 250 mg.
(2S)-2-formamido-3-(1H-imidazol-5-yl)propanoic acid (CAS 15191-21-6) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: (2S)-2-formamido-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: WFQVSLVQIFFQQN-LURJTMIESA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | (2S)-2-formamido-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | WFQVSLVQIFFQQN-LURJTMIESA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)NC=O |
Computed by PubChem (NCBI)