CAS 1173984-09-2 is the registry number for 2-Methoxy-4,6-dimethyl-5-nitropyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methoxy-4,6-dimethyl-5-nitropyrimidine (CAS 1173984-09-2) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: 2-methoxy-4,6-dimethyl-5-nitropyrimidine. InChIKey: KPLDTEBEKUVBDS-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 2-methoxy-4,6-dimethyl-5-nitropyrimidine |
| InChIKey | KPLDTEBEKUVBDS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)OC)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)