cas: 478148-62-8 — see every product listed under this CAS number, including other names
Furo(2,3-c)pyridine-5-carboxylic acid, 98% (CAS 478148-62-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A297042-10g |
| cas | 478148-62-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 21969.64 Pln | |
| AmBeed | 5g | 11065.39 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Furo[2,3-c]pyridine-5-carboxylic acid (CAS 478148-62-8) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: furo[2,3-c]pyridine-5-carboxylic acid. InChIKey: BEVAEUJOJMQCIU-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | furo[2,3-c]pyridine-5-carboxylic acid |
| InChIKey | BEVAEUJOJMQCIU-UHFFFAOYSA-N |
| SMILES | C1=COC2=CN=C(C=C21)C(=O)O |
Computed by PubChem (NCBI)