cas: 478148-62-8 — see every product listed under this CAS number, including other names
Furo[2,3-c]pyridine-5-carboxylic acid, 97%, 97% (CAS 478148-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DHVA-100mg |
| cas | 478148-62-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 2042.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Furo[2,3-c]pyridine-5-carboxylic acid (CAS 478148-62-8) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: furo[2,3-c]pyridine-5-carboxylic acid. InChIKey: BEVAEUJOJMQCIU-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | furo[2,3-c]pyridine-5-carboxylic acid |
| InChIKey | BEVAEUJOJMQCIU-UHFFFAOYSA-N |
| SMILES | C1=COC2=CN=C(C=C21)C(=O)O |
Computed by PubChem (NCBI)