Products 102704-40-5
CAS 102704-40-5 appears in our catalog under these names: GAT211, GAT211/ 99.7% (existing batch purity), 3-(2-Nitro-1-phenylethyl)-2-phenyl-1H-indole, GAT211, 99.98%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
3-(2-nitro-1-phenylethyl)-2-phenyl-1H-indole (CAS 102704-40-5) is a chemical compound with the molecular formula C22H18N2O2 and a molecular weight of 342.4 g/mol. IUPAC name: 3-(2-nitro-1-phenylethyl)-2-phenyl-1H-indole. InChIKey: OHZDCJJHWPHZJD-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 3-(2-nitro-1-phenylethyl)-2-phenyl-1H-indole |
| InChIKey | OHZDCJJHWPHZJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C(C[N+](=O)[O-])C4=CC=CC=C4 |
Computed by PubChem (NCBI)