CAS 349085-82-1 appears in our catalog under these names: GSK137647A/ 99.87% (existing batch purity), GSK 137647, GSK 137647A, GSK137647A 98%, N-Mesityl-4-methoxybenzenesulfonamide, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
4-methoxy-N-(2,4,6-trimethylphenyl)benzenesulfonamide (CAS 349085-82-1) is a chemical compound with the molecular formula C16H19NO3S and a molecular weight of 305.4 g/mol. IUPAC name: 4-methoxy-N-(2,4,6-trimethylphenyl)benzenesulfonamide. InChIKey: FQUAFMNPXPXOJE-UHFFFAOYSA-N.
| Molecular formula | C16H19NO3S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-methoxy-N-(2,4,6-trimethylphenyl)benzenesulfonamide |
| InChIKey | FQUAFMNPXPXOJE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NS(=O)(=O)C2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)