CAS 1693766-04-9 appears in our catalog under these names: GSK8573/ 99.81% (existing batch purity), GSK8573, GSK8573 98%, 1-(1-(3-Methoxyphenyl)-7-propoxyindolizin-3-yl)ethan-1-one, 98%, 98%, GSK8573, 99.72%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
1-[1-(3-methoxyphenyl)-7-propoxyindolizin-3-yl]ethanone (CAS 1693766-04-9) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: 1-[1-(3-methoxyphenyl)-7-propoxyindolizin-3-yl]ethanone. InChIKey: QQBGNWWJANJWNY-UHFFFAOYSA-N.
| Molecular formula | C20H21NO3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 1-[1-(3-methoxyphenyl)-7-propoxyindolizin-3-yl]ethanone |
| InChIKey | QQBGNWWJANJWNY-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC2=C(C=C(N2C=C1)C(=O)C)C3=CC(=CC=C3)OC |
Computed by PubChem (NCBI)