cas: 13404-22-3 — see every product listed under this CAS number, including other names
H-Ala-OtBu·HCl 98% (CAS 13404-22-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133531-1g |
| cas | 13404-22-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 470.50 Pln | |
| Ambeed | 500g | 1950.12 Pln | |
| Ambeed | 1000g | 3079.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A133531 |
Tert-butyl (2S)-2-aminopropanoate;hydrochloride (CAS 13404-22-3) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: tert-butyl (2S)-2-aminopropanoate;hydrochloride. InChIKey: WIQIWPPQGWGVHD-JEDNCBNOSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | tert-butyl (2S)-2-aminopropanoate;hydrochloride |
| InChIKey | WIQIWPPQGWGVHD-JEDNCBNOSA-N |
| SMILES | C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)