cas: 5619-09-0 — see every product listed under this CAS number, including other names
H-DL-Trp-OMe·HCl 97% (CAS 5619-09-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A140352-1g |
| cas | 5619-09-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1115.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A140352 |
Methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 5619-09-0) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)