cas: 69320-89-4 — see every product listed under this CAS number, including other names
H-Ile-OtBu.HCl, 98%, 98% (CAS 69320-89-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117GEW-1g |
| cas | 69320-89-4 |
| size | 1g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 100g | 530.00 Pln | |
| Chemat | 500g | 1857.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 69320-89-4) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: IFRYMHOZFAPYPJ-WSZWBAFRSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | IFRYMHOZFAPYPJ-WSZWBAFRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)