cas: 69320-89-4 — see every product listed under this CAS number, including other names
H-Ile-OtBu.HCl, 98.30% (CAS 69320-89-4) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009734-100 g |
| cas | 69320-89-4 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 695.86 Pln | |
| MedChemExpress | 25 g | 263.96 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.30% |
Tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 69320-89-4) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: IFRYMHOZFAPYPJ-WSZWBAFRSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | IFRYMHOZFAPYPJ-WSZWBAFRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)