cas: 69320-89-4 — see every product listed under this CAS number, including other names
h-lle-otbu.hcl, 97% (CAS 69320-89-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045357-5G |
| cas | 69320-89-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 100g | 518.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 69320-89-4) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: IFRYMHOZFAPYPJ-WSZWBAFRSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | IFRYMHOZFAPYPJ-WSZWBAFRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)