cas: 7524-50-7 — see every product listed under this CAS number, including other names
H-Phe-OMe.HCl, 98%, 98% (CAS 7524-50-7) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 10kg, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114S1U-1kg |
| cas | 7524-50-7 |
| size | 1kg |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 606.80 Pln | |
| Chemat | 5kg | 3120.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 88.40 Pln | |
| Chemat | 100g | 112.40 Pln | |
| Chemat | 250g | 179.60 Pln | |
| Chemat | 500g | 345.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (CAS 7524-50-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-phenylpropanoate;hydrochloride. InChIKey: SWVMLNPDTIFDDY-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | SWVMLNPDTIFDDY-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)