CAS 1331897-23-4 appears in our catalog under these names: L-Phenylalanine-d5 Methyl Ester Hydrochloride, >95% (HPLC), H-Phe-OMe.hydrochloride-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 10 mg.
Methyl (2S)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoate;hydrochloride (CAS 1331897-23-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 220.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoate;hydrochloride. InChIKey: SWVMLNPDTIFDDY-DSGATGSVSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 220.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoate;hydrochloride |
| InChIKey | SWVMLNPDTIFDDY-DSGATGSVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C(=O)OC)N)[2H])[2H].Cl |
Computed by PubChem (NCBI)