CAS 7524-50-7 appears in our catalog under these names: L-Phenylalanine Methyl Ester HCl, L-Phenylalanine Methyl Ester Hydrochloride, >95% (HPLC), L-Phenylalanine Methyl Ester Hydrochloride, L-Phenylalanine methyl ester hydrochloride/ 98%, H–Phe–OMe·HCl. Offered by: Chemat Brand, TRC, Mikromol, Chemat, GLPBio. Available pack sizes: on request, 10g, 25mg, 25g, 100g, 50g, 0,25kg, 0,5kg.
Methyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (CAS 7524-50-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-phenylpropanoate;hydrochloride. InChIKey: SWVMLNPDTIFDDY-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | SWVMLNPDTIFDDY-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)