CAS 128502-56-7 appears in our catalog under these names: H-L-Tic(7-OH)-OH, L–7–Hydroxy–1,2,3,4–tetrahydroisoquinoline–3–carboxylic acid, L-7-Hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid, 95%, 95%, (S)-7-Hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid, 97%. Offered by: Iris Biotech, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g.
(3S)-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (CAS 128502-56-7) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (3S)-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid. InChIKey: HIKCRLDSCSWXML-VIFPVBQESA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (3S)-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| InChIKey | HIKCRLDSCSWXML-VIFPVBQESA-N |
| SMILES | C1[C@H](NCC2=C1C=CC(=C2)O)C(=O)O |
Computed by PubChem (NCBI)