CAS 35186-98-2 appears in our catalog under these names: 7-Hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid, 95%, 7–Hydroxy–1,2,3,4–tetrahydroisoquinoline–3–carboxylic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg.
7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (CAS 35186-98-2) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid. InChIKey: HIKCRLDSCSWXML-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| InChIKey | HIKCRLDSCSWXML-UHFFFAOYSA-N |
| SMILES | C1C(NCC2=C1C=CC(=C2)O)C(=O)O |
Computed by PubChem (NCBI)