H-Trp(5-Br)-OH 97%
cas: 25197-99-3 — see every product listed under this CAS number, including other names
H-Trp(5-Br)-OH 97% (CAS 25197-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A428010-100mg |
| cas | 25197-99-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1505.12 Pln | |
| Ambeed | 25g | 4953.88 Pln | |
| Ambeed | 10g | 2511.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A428010 |
(2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid (CAS 25197-99-3) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid. InChIKey: KZDNJQUJBMDHJW-VIFPVBQESA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | KZDNJQUJBMDHJW-VIFPVBQESA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
5-Bromo-L-tryptophan, (S)-2-Amino-3-(5-bromo-1H-indol-3-yl)propanoic acid, L-tryptophan, 5-bromo-, (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid, 5BrW, (S)-2-Amino-3-(5-bromo-1H-indol-3-yl)propanoicacid, Tryptophan, 5-bromo-, H-Trp(5-Br)-OH, L-Trp(5-Br)-OH, L-5-BromoTryptophan(5-BrW)