cas: 5022-65-1 — see every product listed under this CAS number, including other names
H-Trp-NH2.HCl, 95%, 95% (CAS 5022-65-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9ZJ-250mg |
| cas | 5022-65-1 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 314.00 Pln | |
| Chemat | 500g | 4872.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride (CAS 5022-65-1) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: (2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride. InChIKey: WOBDANBSEWOYKN-FVGYRXGTSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride |
| InChIKey | WOBDANBSEWOYKN-FVGYRXGTSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)