cas: 5022-65-1 — see every product listed under this CAS number, including other names
H-Trp-NH2.HCl, 99.95% (CAS 5022-65-1) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 1 g, 25 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008766-10mM/1mL |
| cas | 5022-65-1 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 25 g | 793.38 Pln | |
| MedChemExpress | 5 g | 310.40 Pln | |
| MedChemExpress | 10 g | 454.37 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.95% |
(2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride (CAS 5022-65-1) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: (2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride. InChIKey: WOBDANBSEWOYKN-FVGYRXGTSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride |
| InChIKey | WOBDANBSEWOYKN-FVGYRXGTSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)