Products 2378406-17-6
CAS 2378406-17-6 appears in our catalog under these names: HA5/ 98.48% (existing batch purity), HA5. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
(2Z)-2-[(2,4,5-trihydroxyphenyl)methylidene]-1-benzofuran-3-one (CAS 2378406-17-6) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: (2Z)-2-[(2,4,5-trihydroxyphenyl)methylidene]-1-benzofuran-3-one. InChIKey: VVYKSKJYFAOSBP-NSIKDUERSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | (2Z)-2-[(2,4,5-trihydroxyphenyl)methylidene]-1-benzofuran-3-one |
| InChIKey | VVYKSKJYFAOSBP-NSIKDUERSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)/C(=C/C3=CC(=C(C=C3O)O)O)/O2 |
Computed by PubChem (NCBI)