CAS 1884231-52-0 appears in our catalog under these names: HDAC8-IN-20a/ 99.01% (existing batch purity), HDAC8–IN–8, HDAC8-IN-20a 98%, HDAC8-IN-8, 99.01%, 3-(Benzyloxy)-N-hydroxy-4-methoxybenzamide, 98%, 98%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
N-hydroxy-4-methoxy-3-phenylmethoxybenzamide (CAS 1884231-52-0) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: N-hydroxy-4-methoxy-3-phenylmethoxybenzamide. InChIKey: IGVRDNCZCPXENL-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | N-hydroxy-4-methoxy-3-phenylmethoxybenzamide |
| InChIKey | IGVRDNCZCPXENL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)NO)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)