Products 1414029-23-4
CAS 1414029-23-4 is the registry number for Methyl 5-(2,5-dimethoxyphenyl)pyridine-2-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 5-(2,5-dimethoxyphenyl)pyridine-2-carboxylate (CAS 1414029-23-4) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: methyl 5-(2,5-dimethoxyphenyl)pyridine-2-carboxylate. InChIKey: PEPZCRORYLMUDM-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | methyl 5-(2,5-dimethoxyphenyl)pyridine-2-carboxylate |
| InChIKey | PEPZCRORYLMUDM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CN=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)