Products 23938-73-0

CAS 23938-73-0 is the registry number for 2-Amino-4-(benzyloxy)-3-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-3-methoxy-4-phenylmethoxybenzoic acid (CAS 23938-73-0) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: 2-amino-3-methoxy-4-phenylmethoxybenzoic acid. InChIKey: YJFMLBRUBORVIM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO4
Molecular weight273.28 g/mol
IUPAC name2-amino-3-methoxy-4-phenylmethoxybenzoic acid
InChIKeyYJFMLBRUBORVIM-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1N)C(=O)O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)