CAS 1533519-87-7 appears in our catalog under these names: 4-Cyclopropylnaphthalen-1-amine oxalate, 95%, 1–aMino–4–cyclopropylnaphthalene oxalate, 4-Cyclopropylnaphthalen-1-amine oxalate 95%, 4-Cyclopropylnaphthalen-1-amine oxalate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 200mg, 250mg.
4-cyclopropylnaphthalen-1-amine;oxalic acid (CAS 1533519-87-7) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: 4-cyclopropylnaphthalen-1-amine;oxalic acid. InChIKey: DDBGBBLAOJBGGO-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 4-cyclopropylnaphthalen-1-amine;oxalic acid |
| InChIKey | DDBGBBLAOJBGGO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)