CAS 67822-74-6 appears in our catalog under these names: 2-Cyclohexyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-Cyclohexyl-1,3-dioxoisoindoline-5-carboxylic acid, 97%, 2-Cyclohexyl-1,3-dioxo-2,3-dihydro-1H -isoindole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g.
2-cyclohexyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 67822-74-6) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: AFBFBNPENNMENY-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | AFBFBNPENNMENY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)