CAS 1050884-51-9 appears in our catalog under these names: (2E)-3-(4-[(3,5-Dimethylisoxazol-4-yl)methoxy]phenyl)acrylic acid, 95%, 3-(4-((3,5-Dimethylisoxazol-4-yl)methoxy)phenyl)acrylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
(E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]prop-2-enoic acid (CAS 1050884-51-9) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]prop-2-enoic acid. InChIKey: BQZPGKUDULVQNI-VMPITWQZSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]prop-2-enoic acid |
| InChIKey | BQZPGKUDULVQNI-VMPITWQZSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)