CAS 31575-93-6 appears in our catalog under these names: Heraclenol/ 99.7% (existing batch purity), Heraclenol, Heraclenol, 99.59%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
9-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one (CAS 31575-93-6) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: 9-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one. InChIKey: FOINLJRVEBYARJ-LLVKDONJSA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | 9-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one |
| InChIKey | FOINLJRVEBYARJ-LLVKDONJSA-N |
| SMILES | CC(C)([C@@H](COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)O)O |
Computed by PubChem (NCBI)