cas: 1205-91-0 — see every product listed under this CAS number, including other names
Hydroquinone diacetate 98% (CAS 1205-91-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A549525-5g |
| cas | 1205-91-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 359.25 Pln | |
| Ambeed | 500g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A549525 |
(4-acetyloxyphenyl) acetate (CAS 1205-91-0) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (4-acetyloxyphenyl) acetate. InChIKey: AKOGNYJNGMLDOA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (4-acetyloxyphenyl) acetate |
| InChIKey | AKOGNYJNGMLDOA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)