CAS 852367-46-5 appears in our catalog under these names: IGF–1R/SRC–IN–1, WAY-270250, WAY-270250/ 99.77% (existing batch purity), WAY-270250 99%, WAY-270250, ≥98%, ≥98%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 500mg, 250mg.
2-(1H-indol-3-yl)-N-[(4-methylphenyl)methyl]-2-oxoacetamide (CAS 852367-46-5) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: 2-(1H-indol-3-yl)-N-[(4-methylphenyl)methyl]-2-oxoacetamide. InChIKey: VDADLUIOHVLGRA-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-N-[(4-methylphenyl)methyl]-2-oxoacetamide |
| InChIKey | VDADLUIOHVLGRA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CNC(=O)C(=O)C2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)