cas: 859833-15-1 — see every product listed under this CAS number, including other names
Imidazo[1,2-a]pyridine-6-carbonyl chloride hydrochloride, Tech. (CAS 859833-15-1) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC33152CB |
| cas | 859833-15-1 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 210.25 Pln | |
| Thermo Scientific | 1g | 646.53 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | .% |
Imidazo[1,2-a]pyridine-6-carbonyl chloride;hydrochloride (CAS 859833-15-1) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: imidazo[1,2-a]pyridine-6-carbonyl chloride;hydrochloride. InChIKey: LHLAJCRPSZDOFF-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | imidazo[1,2-a]pyridine-6-carbonyl chloride;hydrochloride |
| InChIKey | LHLAJCRPSZDOFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C=C1C(=O)Cl.Cl |
Computed by PubChem (NCBI)