cas: 2095678-97-8 — see every product listed under this CAS number, including other names
Isopropyl 4-hydroxy-3,5-diisopropylbenzoate, 98% (CAS 2095678-97-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692309-100MG |
| cas | 2095678-97-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 409.25 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 5g | 3590.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Propan-2-yl 4-hydroxy-3,5-di(propan-2-yl)benzoate (CAS 2095678-97-8) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: propan-2-yl 4-hydroxy-3,5-di(propan-2-yl)benzoate. InChIKey: AQFMOBJQAQLNSL-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | propan-2-yl 4-hydroxy-3,5-di(propan-2-yl)benzoate |
| InChIKey | AQFMOBJQAQLNSL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)C(=O)OC(C)C |
Computed by PubChem (NCBI)